For research use only. Not for therapeutic Use.
Gentisein（Cat No.:I028003）is a flavonoid compound found in various plants, known for its antioxidant and anti-inflammatory properties. It has been studied for its potential therapeutic applications in cancer, neurodegenerative diseases, and cardiovascular conditions. Gentisein is believed to exert its effects by modulating key cellular pathways, including those involved in oxidative stress, apoptosis, and cell signaling. Preclinical studies suggest that it may help protect cells from damage, reduce inflammation, and inhibit tumor growth. However, further clinical research is needed to fully evaluate its safety, efficacy, and potential therapeutic benefits in humans.
| CAS Number | 529-49-7 |
| Synonyms | 1,3,7-trihydroxyxanthen-9-one |
| Molecular Formula | C13H8O5 |
| Purity | ≥95% |
| IUPAC Name | 1,3,7-trihydroxyxanthen-9-one |
| InChI | InChI=1S/C13H8O5/c14-6-1-2-10-8(3-6)13(17)12-9(16)4-7(15)5-11(12)18-10/h1-5,14-16H |
| InChIKey | JJUNZBRHHGLJQW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C3=C(C=C(C=C3O2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
