For research use only. Not for therapeutic Use.
Gemcitabine(Cat No.:A000739)is a nucleoside analog and a widely used chemotherapeutic agent, primarily effective in treating various cancers, including pancreatic, lung, and breast cancer. It functions by inhibiting DNA synthesis and repair, ultimately leading to apoptosis in rapidly dividing cancer cells. As a prodrug, gemcitabine is metabolized to its active form, which incorporates into DNA, disrupting replication. Its efficacy is often enhanced when combined with other chemotherapeutics or targeted therapies. Despite its effectiveness, gemcitabine can cause side effects such as myelosuppression and gastrointestinal disturbances, necessitating careful patient management during treatment.
CAS Number | 95058-81-4 |
Synonyms | LY-188011, NSC 613327 |
Molecular Formula | C9H11F2N3O4 |
Purity | ≥95% |
Target | Autophagy |
Solubility | Soluble in DMSO > 10 mM |
Storage | 3 years -20C powder |
IUPAC Name | 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C9H11F2N3O4/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17)/t4-,6-,7-/m1/s1 |
InChIKey | SDUQYLNIPVEERB-QPPQHZFASA-N |
SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |