For research use only. Not for therapeutic Use.
GDP-L-Fucosedisodiumsalt (Cat No.:L004428) plays a vital role in biochemical processes. It acts as a donor of fucose, a monosaccharide, in glycosylation reactions. Its mode of action involves the enzymatic transfer of fucose from GDP-fucose to acceptor molecules, modulating glycan structures. Pharmacologically, it influences cell signaling and adhesion, impacting cellular recognition events. This compound finds applications in glycobiology research, aiding studies on glycan-protein interactions, and glycosylation-related diseases. Additionally, it contributes to the development of therapeutic interventions targeting glycan-mediated processes, showcasing its significance in advancing our understanding of complex cellular mechanisms and potential medical treatments.
| CAS Number | 148296-47-3 |
| Molecular Formula | C16H23N5Na2O15P2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | disodium;[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phosphate |
| InChI | InChI=1S/C16H25N5O15P2.2Na/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27;;/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27);;/q;2*+1/p-2/t4-,5+,7+,8+,9+,10+,11-,14+,15+;;/m0../s1 |
| InChIKey | BUWGXAMQXMUESR-JLTDHLQRSA-L |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OP(=O)([O-])OP(=O)([O-])OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O)O)O)O)O.[Na+].[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |