For research use only. Not for therapeutic Use.
Gaultherin（Cat No.:I044959）is a natural salicylate glycoside primarily found in Gaultheria species, such as Gaultheria procumbens (wintergreen). It consists of a methyl salicylate moiety linked to a disaccharide, conferring both analgesic and anti-inflammatory properties. Upon enzymatic hydrolysis in the body, gaultherin releases salicylic acid, similar to aspirin, contributing to pain relief and reduced inflammation. Unlike synthetic salicylates, it causes less gastric irritation due to its glycosidic form. Gaultherin is also noted for antioxidant activity and is studied for potential therapeutic applications in musculoskeletal disorders, cardiovascular health, and traditional herbal medicine.
| CAS Number | 490-67-5 |
| Synonyms | methyl 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate |
| Molecular Formula | C19H26O12 |
| Purity | ≥95% |
| IUPAC Name | methyl 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate |
| InChI | InChI=1S/C19H26O12/c1-27-17(26)8-4-2-3-5-10(8)30-19-16(25)14(23)13(22)11(31-19)7-29-18-15(24)12(21)9(20)6-28-18/h2-5,9,11-16,18-25H,6-7H2,1H3/t9-,11-,12+,13-,14+,15-,16-,18+,19-/m1/s1 |
| InChIKey | VHUNCYDAXJGCLO-AHMNSWSSSA-N |
| SMILES | COC(=O)C1=CC=CC=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
