For research use only. Not for therapeutic Use.
GAT211（Cat No.:I027956）is a positive allosteric modulator and direct agonist of the cannabinoid receptor 1 (CB1), part of the endocannabinoid system. Unlike traditional orthosteric ligands, GAT211 enhances CB1 receptor activity without directly competing with endogenous cannabinoids, providing fine-tuned modulation of receptor signaling. It exhibits stereoselective activity, with its enantiomers showing differential effects on CB1. GAT211 is valuable for studying CB1-mediated neurological processes, including pain modulation, appetite control, and neuroprotection. Its unique mechanism makes it a promising tool in cannabinoid research and the development of targeted therapies with fewer psychoactive side effects.
| CAS Number | 102704-40-5 |
| Synonyms | 3-(2-nitro-1-phenylethyl)-2-phenyl-1H-indole |
| Molecular Formula | C22H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | 3-(2-nitro-1-phenylethyl)-2-phenyl-1H-indole |
| InChI | InChI=1S/C22H18N2O2/c25-24(26)15-19(16-9-3-1-4-10-16)21-18-13-7-8-14-20(18)23-22(21)17-11-5-2-6-12-17/h1-14,19,23H,15H2 |
| InChIKey | OHZDCJJHWPHZJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(C[N+](=O)[O-])C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
