For research use only. Not for therapeutic Use.
Gardenin B(CAT: R014684) is a natural compound that belongs to the group of flavonoids. It is found in various plant sources and has garnered attention for its potential pharmacological activities. While specific information about Gardenin B may be limited, flavonoids, in general, are known for their diverse bioactive properties, including antioxidant, anti-inflammatory, and potentially anticancer effects. Gardenin B’s unique structure and potential biological activities make it an intriguing subject of research in the field of natural products and medicinal chemistry.
CAS Number | 2798-20-1 |
Molecular Formula | C19H18O7 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 5-hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3 |
InChIKey | LXEVSYZNYDZSOB-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C(=C3O)OC)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |