For research use only. Not for therapeutic Use.
Ganoderenic acid B(Cat No.:M007867)is a lanostane-type triterpenoid isolated from the medicinal mushroom Ganoderma lucidum. It is known for its hepatoprotective, antioxidant, and antitumor properties, contributing to the therapeutic profile of G. lucidum extracts. Ganoderenic acid B has demonstrated the ability to inhibit cholesterol synthesis, modulate inflammatory pathways, and induce apoptosis in certain cancer cell lines. It is widely studied in pharmacological and natural product research for its potential in liver disease treatment, cancer therapy, and metabolic regulation.
| CAS Number | 100665-41-6 |
| Synonyms | (E)-6-[(3S,7S,10S,13R,14R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxohept-5-enoic acid |
| Molecular Formula | C30H42O7 |
| Purity | ≥95% |
| IUPAC Name | 6-(3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid |
| InChI | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-22,32,34H,8-9,11-14H2,1-7H3,(H,36,37) |
| InChIKey | QECQJYAIIIIKJB-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |