For research use only. Not for therapeutic Use.
FzM1（Cat No.:R066111）is a selective small-molecule antagonist of the Frizzled-4 (Fzd4) receptor, a key mediator in the Wnt signaling pathway. By specifically inhibiting Fzd4, FzM1 disrupts Wnt-driven processes critical for vascular development, angiogenesis, and tumor progression. Its targeted action makes FzM1 an essential research tool for investigating the role of Wnt-Fzd signaling in diseases characterized by abnormal angiogenesis, such as cancer, diabetic retinopathy, and other vascular disorders. Additionally, FzM1 aids in elucidating the molecular mechanisms underlying pathological vascularization and offers potential avenues for therapeutic intervention against Wnt pathway-associated diseases.
| CAS Number | 1680196-54-6 |
| Synonyms | 1-(3-hydroxy-5-thiophen-2-ylphenyl)-3-naphthalen-2-ylurea |
| Molecular Formula | C21H16N2O2S |
| Purity | ≥95% |
| IUPAC Name | 1-(3-hydroxy-5-thiophen-2-ylphenyl)-3-naphthalen-2-ylurea |
| InChI | InChI=1S/C21H16N2O2S/c24-19-12-16(20-6-3-9-26-20)11-18(13-19)23-21(25)22-17-8-7-14-4-1-2-5-15(14)10-17/h1-13,24H,(H2,22,23,25) |
| InChIKey | OBTSACXGWYGCPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)NC3=CC(=CC(=C3)C4=CC=CS4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
