For research use only. Not for therapeutic Use.
Futoquinol（Cat No.:R019467）is a naturally occurring phenolic compound isolated from marine and terrestrial organisms, including certain fungi and algae. It features a substituted hydroquinone structure, contributing to its notable antioxidant and antimicrobial properties. Futoquinol has been studied for its ability to scavenge reactive oxygen species and inhibit microbial growth, making it of interest in the development of natural preservatives and therapeutic agents. Its redox-active nature also suggests potential roles in modulating cellular oxidative stress. As a small, bioactive molecule, futoquinol holds promise in pharmaceutical and nutraceutical research targeting inflammation and infection.
| CAS Number | 28178-92-9 |
| Synonyms | 4-[(E)-1-(1,3-benzodioxol-5-yl)prop-1-en-2-yl]-4,5-dimethoxy-2-prop-2-enylcyclohexa-2,5-dien-1-one |
| Molecular Formula | C21H22O5 |
| Purity | ≥95% |
| IUPAC Name | 4-[(E)-1-(1,3-benzodioxol-5-yl)prop-1-en-2-yl]-4,5-dimethoxy-2-prop-2-enylcyclohexa-2,5-dien-1-one |
| InChI | InChI=1S/C21H22O5/c1-5-6-16-12-21(24-4,20(23-3)11-17(16)22)14(2)9-15-7-8-18-19(10-15)26-13-25-18/h5,7-12H,1,6,13H2,2-4H3/b14-9+ |
| InChIKey | AOZTYYBGNNXAOI-NTEUORMPSA-N |
| SMILES | C/C(=C\C1=CC2=C(C=C1)OCO2)/C3(C=C(C(=O)C=C3OC)CC=C)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
