For research use only. Not for therapeutic Use.
Furan-2,3-dicarboxylic acid is a dicarboxylic acid with a furan ring and carboxyl groups at the 2- and 3-positions, commonly used in pharmaceutical, polymer, and materials science research. Its structure provides two reactive sites, making it valuable as an intermediate for synthesizing bioactive compounds and specialty materials. This compound is particularly useful in developing sustainable polymers and as a building block in medicinal chemistry for creating heterocyclic compounds. Its stability and reactivity support applications in organic synthesis and green chemistry.
| CAS Number | 4282-24-0 |
| Molecular Formula | C6H4O5 |
| Purity | ≥95% |
| IUPAC Name | furan-2,3-dicarboxylic acid |
| InChI | InChI=1S/C6H4O5/c7-5(8)3-1-2-11-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | DNXDYHALMANNEJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |