For research use only. Not for therapeutic Use.
Fumaric Acid Monoethyl Ester(Cat No.:R057472)is a key intermediate used in organic synthesis and pharmaceutical research. This ester derivative of fumaric acid plays a crucial role in the development of drugs, particularly those targeting autoimmune and inflammatory conditions. Its ability to modulate the immune response makes it valuable in the synthesis of compounds for treating multiple sclerosis and psoriasis. With its high purity and consistent quality, Fumaric Acid Monoethyl Ester is essential for research applications requiring precise chemical reactions and reliable results. Ideal for advanced medicinal chemistry projects.
CAS Number | 2459-05-4 |
Synonyms | (2E)-2-Butenedioic Acid 1-Ethyl Ester; (2E)-2-Butenedioic Acid Monoethyl Ester; Fumaric Acid Ethyl Ester; (E)-4-Ethoxy-4-oxo-2-butenoic Acid; Ethyl Hydrogen Fumarate; Monoethyl Fumarate; Monoethyl Fumerate; Monoethyl trans-2-Butenedioate; |
Molecular Formula | C6H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-4-ethoxy-4-oxobut-2-enoic acid |
InChI | InChI=1S/C6H8O4/c1-2-10-6(9)4-3-5(7)8/h3-4H,2H2,1H3,(H,7,8)/b4-3+ |
InChIKey | XLYMOEINVGRTEX-ONEGZZNKSA-N |
SMILES | CCOC(=O)C=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |