For research use only. Not for therapeutic Use.
FUMARIC ACID, [1,4-14C] (Cat. No: M088529) is a C14 marker that can be used as an isotope marker for the preparation of chemical raw materials, mainly for scientific research.
| CAS Number | 17456-38-1 |
| Synonyms | FUMARIC ACID, [1,4-14C] |
| Molecular Formula | C4H4O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (E)-but-2-enedioic acid |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i3+2,4+2 |
| InChIKey | VZCYOOQTPOCHFL-QJQQQGIFSA-N |
| SMILES | C(=CC(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |