For research use only. Not for therapeutic Use.
Fructosyl Glycine α/β Mixture(CAT; R063068) is a compound that results from the glycation reaction between fructose and glycine, producing both the alpha and beta anomers. Glycation involves the non-enzymatic attachment of a sugar molecule, such as fructose, to an amino acid like glycine. This mixture is relevant in studies of the Maillard reaction, which plays a significant role in food chemistry, particularly in the browning process and flavor development during cooking. Additionally, fructosyl amino acids are often used as biomarkers in diabetes research to assess long-term blood sugar levels, as glycation can reflect cumulative glucose exposure over time.
| CAS Number | 60644-20-4 |
| Synonyms | N-(1-Deoxy-β-D-fructopyranos-1-yl)glycine; 1-[(Carboxymethyl)amino]-1-deoxy-β-D-fructopyranose; |
| Molecular Formula | C8H15NO7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]acetic acid |
| InChI | InChI=1S/C8H15NO7/c10-4-2-16-8(15,7(14)6(4)13)3-9-1-5(11)12/h4,6-7,9-10,13-15H,1-3H2,(H,11,12)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | BVWXBDYZZFSXIL-CCXZUQQUSA-N |
| SMILES | C1C(C(C(C(O1)(CNCC(=O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |