For research use only. Not for therapeutic Use.
Fraxinol（Cat No.:R002385）is a natural coumarin derivative found in plants such as Fraxinus rhynchophylla and other medicinal species. It exhibits a broad spectrum of biological activities, including antioxidant, anti-inflammatory, hepatoprotective, and anticancer effects. Fraxinol scavenges reactive oxygen species, reduces oxidative stress, and modulates signaling pathways like NF-κB and MAPK to suppress inflammation and induce apoptosis in tumor cells. It has been studied for potential therapeutic applications in liver protection, cardiovascular health, and cancer prevention. As a bioactive natural product, fraxinol serves as a promising lead compound in pharmacological research.
| CAS Number | 486-28-2 |
| Synonyms | 6-hydroxy-5,7-dimethoxychromen-2-one |
| Molecular Formula | C11H10O5 |
| Purity | ≥95% |
| IUPAC Name | 6-hydroxy-5,7-dimethoxychromen-2-one |
| InChI | InChI=1S/C11H10O5/c1-14-8-5-7-6(3-4-9(12)16-7)11(15-2)10(8)13/h3-5,13H,1-2H3 |
| InChIKey | PBPNOAHYDPHKFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C=CC(=O)OC2=C1)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
