For research use only. Not for therapeutic Use.
Fotemustine(Cat No.:I005484)is an alkylating agent used in the treatment of various cancers, particularly metastatic melanoma. It is a nitrosourea compound that works by adding alkyl groups to the DNA of cancer cells, disrupting their ability to replicate and ultimately leading to cell death. Fotemustine is often used in patients who have not responded to other therapies, and it can be administered intravenously or topically. Its effectiveness in treating melanoma and certain other cancers has been demonstrated in clinical trials, but its use is associated with potential side effects, including bone marrow suppression and nausea.
| CAS Number | 92118-27-9 |
| Synonyms | S-10036 |
| Molecular Formula | C9H19ClN3O5P |
| Purity | ≥95% |
| Target | DNA alkylator/crosslinker |
| Solubility | DMSO:≥ 3 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 1-(2-chloroethyl)-3-(1-diethoxyphosphorylethyl)-1-nitrosourea |
| InChI | InChI=1S/C9H19ClN3O5P/c1-4-17-19(16,18-5-2)8(3)11-9(14)13(12-15)7-6-10/h8H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | YAKWPXVTIGTRJH-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C(C)NC(=O)N(CCCl)N=O)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |