For research use only. Not for therapeutic Use.
Fosdenopterin (CAS 150829-29-1) is a synthetic form of 6R-BH4 (tetrahydrobiopterin), a crucial cofactor for the biosynthesis of neurotransmitters and nitric oxide. As a pharmacological analog, fosdenopterin is investigated for its potential in the treatment of diseases associated with deficiencies in BH4, such as phenylketonuria (PKU) and certain neuropsychiatric disorders. By replenishing BH4 levels, fosdenopterin aims to address the underlying metabolic imbalances and improve neurotransmitter synthesis.
| CAS Number | 150829-29-1 |
| Synonyms | cPMP; C(pmp) |
| Molecular Formula | C10H14N5O8P |
| Purity | 98% |
| Target | Molybdopterin synthase catalytic subunit |
| Target Protein | O96007 |
| Appearance | Solid |
| IUPAC Name | (1R,10R,12S,17R)-5-amino-11,11,14-trihydroxy-14-oxo-13,15,18-trioxa-2,4,6,9-tetraza-14λ5-phosphatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-dien-7-one |
| InChI | InChI=1S/C10H14N5O8P/c11-9-14-6-3(7(16)15-9)12-4-8(13-6)22-2-1-21-24(19,20)23-5(2)10(4,17)18/h2,4-5,8,12,17-18H,1H2,(H,19,20)(H4,11,13,14,15,16)/t2-,4-,5+,8-/m1/s1 |
| InChIKey | CZAKJJUNKNPTTO-AJFJRRQVSA-N |
| SMILES | C1C2C(C(C3C(O2)NC4=C(N3)C(=O)NC(=N4)N)(O)O)OP(=O)(O1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |