For research use only. Not for therapeutic Use.
Formycin B (Cat.No:M058130) is a naturally occurring nucleoside antibiotic derived from Streptomyces cultures. It possesses antiviral properties due to its inhibition of nucleic acid synthesis. Formycin B’s unique structure, resembling nucleosides, contributes to its potential in antiviral and antitumor research, making it valuable in medicinal chemistry investigations.
CAS Number | 13877-76-4 |
Synonyms | Laurusin; Ohyamycin; 1,4-DIHYDRO-3-BETA-D-RIBOFURANOSYL-7H-PYRAZOLO[4,3-D]PYRIMIDIN-7-ONE |
Molecular Formula | C10H12N4O5 |
Purity | 97% |
Storage | Store at -20°C |
IUPAC Name | 3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dihydropyrazolo[4,3-d]pyrimidin-7-one |
InChI | InChI=1S/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7-,8-,9+/m1/s1 |
InChIKey | MTCJZZBQNCXKAP-KSYZLYKTSA-N |
SMILES | C1=NC(=O)C2=NNC(=C2N1)C3C(C(C(O3)CO)O)O |
Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Wu, Xiaochun, Andrew C. Hui, and Kathleen M. Giacomini. "Formycin B elimination from the cerebrospinal fluid of the rat." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Pharmaceutical research</i> 10.4 (1993): 611-615.<br /> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |