For research use only. Not for therapeutic Use.
Follicle-stimulating hormone (Cat No.:M104478) is a glycoprotein hormone crucial for reproductive health, secreted by the anterior pituitary gland. It plays a key role in regulating the growth, development, pubertal maturation, and reproductive processes of the human body. In females, FSH is essential for the growth and maturation of ovarian follicles; in males, it stimulates spermatogenesis by acting on the Sertoli cells of the testes. Its levels vary throughout life and are instrumental in the diagnosis and treatment of various fertility issues and disorders like polycystic ovary syndrome (PCOS) and hypogonadism.
Catalog Number | M104478 |
CAS Number | 146479-72-3 |
Molecular Formula | C42H65N11O12S2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 1-[19-amino-7-(2-amino-2-oxoethyl)-13-butan-2-yl-10-(1-hydroxyethyl)-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
InChI | InChI=1S/C42H65N11O12S2/c1-6-21(4)33-40(63)52-34(22(5)54)41(64)49-28(16-31(44)56)37(60)50-29(19-67-66-18-25(43)35(58)47-27(38(61)51-33)15-23-9-11-24(55)12-10-23)42(65)53-13-7-8-30(53)39(62)48-26(14-20(2)3)36(59)46-17-32(45)57/h9-12,20-22,25-30,33-34,54-55H,6-8,13-19,43H2,1-5H3,(H2,44,56)(H2,45,57)(H,46,59)(H,47,58)(H,48,62)(H,49,64)(H,50,60)(H,51,61)(H,52,63) |
InChIKey | ZDRRIRUAESZNIH-UHFFFAOYSA-N |
SMILES | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)C(C)O |