For research use only. Not for therapeutic Use.
Folate-PEG3-C2-acid(CAT: I040207) is a carboxylic acid-terminated fragment of Folate-PEG3-NHS ester (HY-133493) and functions as a PEG-based linker for the synthesis of PROTAC (proteolysis targeting chimera) molecules. Incorporating a PEG3 spacer and a folate moiety, this linker facilitates enhanced solubility, biocompatibility, and targeted delivery—especially to folate receptor-expressing cancer cells. The terminal carboxyl group allows for versatile amide coupling reactions, enabling conjugation to ligands or E3 ligase recruiters. Folate-PEG3-C2-acid is widely used in designing tumor-targeted PROTACs, offering a modular platform for creating degraders with improved pharmacokinetic properties and tissue-specific activity.
| Synonyms | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| Molecular Formula | C28H36N8O10 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| InChI | InChI=1S/C28H36N8O10/c29-28-35-24-23(26(41)36-28)33-19(16-32-24)15-31-18-3-1-17(2-4-18)25(40)34-20(27(42)43)5-6-21(37)30-8-10-45-12-14-46-13-11-44-9-7-22(38)39/h1-4,16,20,31H,5-15H2,(H,30,37)(H,34,40)(H,38,39)(H,42,43)(H3,29,32,35,36,41)/t20-/m0/s1 |
| InChIKey | ZRMDXRKPSYWJMC-FQEVSTJZSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)NCCOCCOCCOCCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |