For research use only. Not for therapeutic Use.
FNC-TP (Cat No.:I044431) is the active triphosphate form of the nucleoside analog FNC (also called Azvudine), a synthetic cytidine analog with potent antiviral activity. FNC-TP is incorporated into viral RNA by RNA-dependent RNA polymerases (RdRp), leading to chain termination and inhibition of viral replication. It has demonstrated efficacy against a range of RNA viruses, including HIV, HCV, and coronaviruses. As the pharmacologically active metabolite, FNC-TP plays a crucial role in mediating the antiviral effects of FNC, making it an essential compound for virology and antiviral drug development research.
| CAS Number | 2457357-99-0 |
| Synonyms | [[(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| Molecular Formula | C9H14FN6O13P3 |
| Purity | ≥95% |
| IUPAC Name | [[(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChI | InChI=1S/C9H14FN6O13P3/c10-5-6(17)9(14-15-12,27-7(5)16-2-1-4(11)13-8(16)18)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h1-2,5-7,17H,3H2,(H,22,23)(H,24,25)(H2,11,13,18)(H2,19,20,21)/t5-,6-,7+,9+/m0/s1 |
| InChIKey | BRACSMALKQTJNX-XZMZPDFPSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@](O2)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-])O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
