For research use only. Not for therapeutic Use.
FmocNH-PEG3-CH2CH2NH2 hydrochloride(Cat No.:I044705)is a compound commonly used in peptide synthesis and drug development. It consists of an Fmoc (9-fluorenylmethoxycarbonyl) protective group on the amine, which enables controlled deprotection during synthesis. The PEG3 (polyethylene glycol) spacer enhances water solubility and biocompatibility, while the CH2CH2NH2 moiety provides a primary amine group for further conjugation with peptides, proteins, or other biomolecules. The hydrochloride salt form ensures stability and solubility in aqueous solutions. This compound is valuable for creating targeted therapeutics, improving pharmacokinetics, and enhancing drug delivery systems.
CAS Number | 906079-91-2 |
Synonyms | 9H-fluoren-9-ylmethyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate;hydrochloride |
Molecular Formula | C23H31ClN2O5 |
Purity | ≥95% |
IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate;hydrochloride |
InChI | InChI=1S/C23H30N2O5.ClH/c24-9-11-27-13-15-29-16-14-28-12-10-25-23(26)30-17-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22;/h1-8,22H,9-17,24H2,(H,25,26);1H |
InChIKey | SEZIMCXPIBEZBJ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |