For research use only. Not for therapeutic Use.
Fmoc-Ser(tBu)-OH（Cat No.:L014980）is a protected form of the amino acid serine used in solid-phase peptide synthesis (SPPS). It features an Fmoc (9-fluorenylmethyloxycarbonyl) group protecting the amino terminus and a tert-butyl (tBu) group protecting the hydroxyl side chain of serine. These protecting groups prevent unwanted side reactions during peptide elongation and can be selectively removed under specific conditions—Fmoc with mild base and tBu with acid. Fmoc-Ser(tBu)-OH is widely used in automated peptide synthesis, allowing precise incorporation of serine residues while preserving functional group integrity until final deprotection.
| CAS Number | 71989-33-8 |
| Molecular Formula | C22H25NO5 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChI | InChI=1S/C22H25NO5/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m0/s1 |
| InChIKey | REITVGIIZHFVGU-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
