For research use only. Not for therapeutic Use.
Fmoc-Phe(3,5-DiF)-OH(Cat No.:I043133)is a modified form of the amino acid phenylalanine, where the phenyl group is substituted with two fluorine atoms at the 3 and 5 positions (3,5-DiF). The amino group is protected with a 9-fluorenylmethyloxycarbonyl (Fmoc) group, enabling selective peptide synthesis. This derivative is used in solid-phase peptide synthesis (SPPS) to incorporate fluorine-modified phenylalanine into peptides, which can influence peptide structure and stability. Fmoc-Phe(3,5-DiF)-OH is useful in research involving protein folding, structural studies, and designing peptides with enhanced stability or specific binding properties for therapeutic applications.
| CAS Number | 205526-24-5 |
| Synonyms | (2S)-3-(3,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| Molecular Formula | C24H19F2NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-3-(3,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChI | InChI=1S/C24H19F2NO4/c25-15-9-14(10-16(26)12-15)11-22(23(28)29)27-24(30)31-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,12,21-22H,11,13H2,(H,27,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | UYEQBZISDRNPFC-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC(=C4)F)F)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |