For research use only. Not for therapeutic Use.
Fmoc-Phe-Ser(ψ(Me,Me)pro)-OH (Cat No.: I006788) is a synthetic dipeptide analog used in peptide synthesis, particularly in the development of peptidomimetics. It features a modified serine residue with a ψ(Me,Me)pro moiety, a non-hydrolyzable isostere that mimics the peptide bond while enhancing metabolic stability and resistance to enzymatic degradation. The Fmoc (9-fluorenylmethyloxycarbonyl) group protects the N-terminus, making it suitable for solid-phase peptide synthesis (SPPS). This analog is valuable in drug design, helping to improve the pharmacokinetic properties of therapeutic peptide candidates.
CAS Number | 878797-01-4 |
Synonyms | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
Molecular Formula | C30H30N2O6 |
Purity | ≥95% |
IUPAC Name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
InChI | InChI=1S/C30H30N2O6/c1-30(2)32(26(18-38-30)28(34)35)27(33)25(16-19-10-4-3-5-11-19)31-29(36)37-17-24-22-14-8-6-12-20(22)21-13-7-9-15-23(21)24/h3-15,24-26H,16-18H2,1-2H3,(H,31,36)(H,34,35)/t25-,26-/m0/s1 |
InChIKey | PQJUKTSKOYOXMZ-UIOOFZCWSA-N |
SMILES | CC1(N(C(CO1)C(=O)O)C(=O)C(CC2=CC=CC=C2)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |