For research use only. Not for therapeutic Use.
Fmoc-NH-PEG8-CH2CH2COOH is a cleavable ADC linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). It consists of a polyethylene glycol (PEG) spacer attached to a carboxylic acid moiety, which facilitates its conjugation to an antibody or other targeting molecule. The Fmoc group serves as a protecting group that can be removed under specific conditions, allowing for the release of the drug payload from the ADC once it reaches its target. This linker design provides a controlled and site-specific drug release, enhancing the therapeutic efficacy of ADCs in targeted cancer therapy.
CAS Number | 756526-02-0 |
Molecular Formula | C₃₄H₄₉NO₁₂ |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C34H49NO12/c36-33(37)9-11-39-13-15-41-17-19-43-21-23-45-25-26-46-24-22-44-20-18-42-16-14-40-12-10-35-34(38)47-27-32-30-7-3-1-5-28(30)29-6-2-4-8-31(29)32/h1-8,32H,9-27H2,(H,35,38)(H,36,37) |
InChIKey | VYXGUCLTEWCVRY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Reference | [1]. Fulcher JM, et al. Chemical synthesis of Shiga toxin subunit B using a next-generation traceless “helping hand” solubilizing tag. Org Biomol Chem. 2019 Dec 28;17(48):10237-10244. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |