For research use only. Not for therapeutic Use.
Fmoc-Lys(ME,Boc)-OH(Cat No.:L040723)is a protected lysine derivative commonly used in peptide synthesis. The lysine side chain is modified with a methyl ester (ME) and a Boc (tert-butyloxycarbonyl) protecting group, while the N-terminal is protected by an Fmoc (9-fluorenylmethoxycarbonyl) group. These protections ensure selective deprotection and coupling during peptide assembly, making it a crucial building block in solid-phase peptide synthesis (SPPS). Fmoc-Lys(ME,Boc)-OH is particularly valuable in creating complex peptides and proteins, allowing for precise control over the structure and function of the final product.
| CAS Number | 951695-85-5 |
| Molecular Formula | C27H34N2O6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
| InChI | InChI=1S/C27H34N2O6/c1-27(2,3)35-26(33)29(4)16-10-9-15-23(24(30)31)28-25(32)34-17-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h5-8,11-14,22-23H,9-10,15-17H2,1-4H3,(H,28,32)(H,30,31)/t23-/m0/s1 |
| InChIKey | JHMSFOFHTAYQLS-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |