For research use only. Not for therapeutic Use.
Fmoc-L-Leu-OH (Cat No.: R020229) is a protected amino acid derivative used in solid-phase peptide synthesis (SPPS). It consists of L-leucine, a branched-chain hydrophobic amino acid, with its amino group protected by a fluorenylmethyloxycarbonyl (Fmoc) group. The Fmoc protection ensures selective deprotection under mild basic conditions, preserving the integrity of other functional groups during peptide assembly. Fmoc-L-Leu-OH is essential in constructing peptides and proteins with specific sequences, particularly where leucine’s bulky, nonpolar side chain contributes to structural stability and biological activity.
| CAS Number | 35661-60-0 |
| Synonyms | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-leucine; (2S)-2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]-4-methylpentanoic Acid; (S)-N-Fmoc-leucine; 217: PN: US20070042401 PAGE: 29 claimed protein; 908: PN: WO2006135786 PAGE: 58 claimed protein; Fmoc-leuc |
| Molecular Formula | C21H23NO4 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Storage | Room temperature |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| InChI | InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | CBPJQFCAFFNICX-IBGZPJMESA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
