For research use only. Not for therapeutic Use.
Fmoc-L-β-methylisoleucine（Cat No.:I043243）is a derivative of the amino acid β-methylisoleucine, where the amino group is protected with a 9-fluorenylmethyloxycarbonyl (Fmoc) group. This protection enables selective peptide synthesis by preventing unwanted reactions at the amino group during peptide chain elongation. Fmoc-L-β-methylisoleucine is used in solid-phase peptide synthesis (SPPS) to incorporate β-methylisoleucine, a branched-chain amino acid, into peptides. It is commonly utilized in the creation of peptides with specific structural properties or bioactivities, often in research related to protein function, enzymatic activity, and drug development targeting various diseases.
| CAS Number | 1227750-73-3 |
| Synonyms | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpentanoic acid |
| Molecular Formula | C22H25NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpentanoic acid |
| InChI | InChI=1S/C22H25NO4/c1-4-22(2,3)19(20(24)25)23-21(26)27-13-18-16-11-7-5-9-14(16)15-10-6-8-12-17(15)18/h5-12,18-19H,4,13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | KTFMEQGAIAYJMN-LJQANCHMSA-N |
| SMILES | CCC(C)(C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
