For research use only. Not for therapeutic Use.
Fmoc-Gly-OH-2,2-d2(Cat No.:S000714) is a deuterated form of Fmoc-Gly-OH, where two hydrogen atoms at the α-carbon are replaced with deuterium, enhancing its molecular stability. This specific deuteration makes it highly suitable as an internal standard in precise analytical methods such as mass spectrometry and NMR spectroscopy. Fmoc-Gly-OH is a glycine derivative protected by a fluorenylmethyloxycarbonyl (Fmoc) group, extensively used in peptide synthesis. The introduction of deuterium in Fmoc-Gly-OH-2,2-d2 provides more accurate insights into peptide dynamics, facilitating detailed studies of peptide stability, assembly, and reactions in chemical and biological research.
| CAS Number | 284665-11-8 |
| Molecular Formula | C17H13D2NO4 |
| Purity | ≥95% |
| IUPAC Name | 2,2-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChI | InChI=1S/C17H15NO4/c19-16(20)9-18-17(21)22-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,18,21)(H,19,20)/i9D2 |
| InChIKey | NDKDFTQNXLHCGO-KNXIQCGSSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |