For research use only. Not for therapeutic Use.
Fmoc-Asp-NH2(Cat No.:I016877), is a derivative of aspartic acid commonly used in peptide synthesis. It features the Fmoc (9-fluorenyl methoxycarbonyl) protecting group, which safeguards the amino group during peptide assembly. Fmoc-Asp-NH2 offers stability and compatibility with solid-phase peptide synthesis methods. It serves as a crucial building block for the construction of peptides and peptide analogs in various research and pharmaceutical applications. This compound enables the development of peptide-based therapeutics and aids in drug discovery efforts, making it an important tool in the field of peptide chemistry.
CAS Number | 200335-40-6 |
Molecular Formula | C₁₉H₁₈N₂O₅ |
Purity | ≥95% |
Target | ADC Linker |
Storage | 2-8°C |
IUPAC Name | (3S)-4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
InChI | InChI=1S/C19H18N2O5/c20-18(24)16(9-17(22)23)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,24)(H,21,25)(H,22,23)/t16-/m0/s1 |
InChIKey | VHRMWRHTRSQVJJ-INIZCTEOSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |