For research use only. Not for therapeutic Use.
| CAS Number | 908847-42-7 |
| Synonyms | 6-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tryptophan; ?Fmoc-6-chloro (S)-Tryptophan; |
| Molecular Formula | C26H21ClN2O4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (2S)-3-(6-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChI | InChI=1S/C26H21ClN2O4/c27-16-9-10-17-15(13-28-23(17)12-16)11-24(25(30)31)29-26(32)33-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22,24,28H,11,14H2,(H,29,32)(H,30,31)/t24-/m0/s1 |
| InChIKey | FDXGPPBWOOAVEL-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CNC5=C4C=CC(=C5)Cl)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |