For research use only. Not for therapeutic Use.
FM19G11（Cat No.:I014828）is a small-molecule inhibitor of hypoxia-inducible factor (HIF) activity, a key regulator of cellular adaptation to low oxygen conditions. By blocking HIF-mediated transcription, FM19G11 suppresses the expression of hypoxia-responsive genes involved in angiogenesis, glycolysis, and survival pathways. It has demonstrated potential in research on cancer, neurodegeneration, and stem cell biology, where HIF signaling plays a critical role. FM19G11 is also used to study metabolic reprogramming and tissue responses to hypoxia. Its specificity makes it a valuable probe for investigating oxygen-sensing mechanisms and therapeutic targeting of HIF pathways.
| CAS Number | 329932-55-0 |
| Synonyms | [2-(4-methylphenyl)-2-oxoethyl] 3-[(2,4-dinitrobenzoyl)amino]benzoate |
| Molecular Formula | C23H17N3O8 |
| Purity | ≥95% |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3-[(2,4-dinitrobenzoyl)amino]benzoate |
| InChI | InChI=1S/C23H17N3O8/c1-14-5-7-15(8-6-14)21(27)13-34-23(29)16-3-2-4-17(11-16)24-22(28)19-10-9-18(25(30)31)12-20(19)26(32)33/h2-12H,13H2,1H3,(H,24,28) |
| InChIKey | XVUOIWIIQVGWAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)COC(=O)C2=CC(=CC=C2)NC(=O)C3=C(C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
