For research use only. Not for therapeutic Use.
Fluroxypyr-meptyl（Cat No.:R018770）is the meptyl ester form of fluroxypyr, a selective systemic herbicide used primarily for post-emergent control of broadleaf weeds in cereal crops, pastures, and non-crop areas. It acts as a synthetic auxin, mimicking natural plant hormones to disrupt cell growth processes, leading to abnormal growth and eventual plant death. The meptyl ester enhances the herbicide’s lipophilicity, improving absorption and translocation within the plant. Fluroxypyr-meptyl is valued for its effectiveness, crop safety, and compatibility with other herbicides, making it a versatile tool in integrated weed management programs.
| CAS Number | 81406-37-3 |
| Synonyms | octan-2-yl 2-(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxyacetate |
| Molecular Formula | C15H21Cl2FN2O3 |
| Purity | ≥95% |
| IUPAC Name | octan-2-yl 2-(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxyacetate |
| InChI | InChI=1S/C15H21Cl2FN2O3/c1-3-4-5-6-7-9(2)23-10(21)8-22-15-12(17)13(19)11(16)14(18)20-15/h9H,3-8H2,1-2H3,(H2,19,20) |
| InChIKey | OLZQTUCTGLHFTQ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)COC1=NC(=C(C(=C1Cl)N)Cl)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
