For research use only. Not for therapeutic Use.
Flumethasone(CAT: A000824) is a synthetic corticosteroid with potent anti-inflammatory and immunosuppressive properties, belonging to the glucocorticoid class. Its molecular formula is C₂₂H₂₈F₂O₄, and it contains fluorine atoms that enhance its biological activity. Flumethasone is commonly used in veterinary and human medicine for treating conditions such as allergic reactions, skin disorders, and autoimmune diseases. It appears as a white to off-white crystalline powder, sparingly soluble in water but soluble in alcohol and acetone. As a steroidal compound, flumethasone works by modulating gene expression to reduce inflammation and suppress immune responses, making it a critical tool in managing chronic inflammatory diseases.
| CAS Number | 2135-17-3 |
| Synonyms | Flumetasone; 2135-17-3; Aniprime; Flucorticin; Flumethason |
| Molecular Formula | C22H28F2O5 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| InChI | 1S/C22H28F2O5/c1-11-6-13-14-8-16(23)15-7-12(26)4-5-19(15,2)21(14,24)17(27)9-20(13,3)22(11,29)18(28)10-25/h4-5,7,11,13-14,16-17,25,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | WXURHACBFYSXBI-GQKYHHCASA-N |
| SMILES | CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
