For research use only. Not for therapeutic Use.
Fludrocortisone(Cat No.:I001091)is a synthetic corticosteroid with potent mineralocorticoid properties, used primarily to treat conditions such as Addison’s disease and orthostatic hypotension. By mimicking the action of aldosterone, it helps regulate sodium and water balance in the body, maintaining blood pressure and electrolyte levels. Its high efficacy and stability make it essential for managing adrenal insufficiency and other disorders related to inadequate adrenal hormone production. Fludrocortisone is crucial in clinical settings for restoring and maintaining physiological homeostasis in patients with adrenal gland dysfunctions, significantly improving their quality of life.
| CAS Number | 127-31-1 |
| Molecular Formula | C21H29FO5 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | 140 mg/L in H2O |
| Storage | Desiccate at -20°C |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H29FO5/c1-18-7-5-13(24)9-12(18)3-4-15-14-6-8-20(27,17(26)11-23)19(14,2)10-16(25)21(15,18)22/h9,14-16,23,25,27H,3-8,10-11H2,1-2H3/t14-,15-,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | AAXVEMMRQDVLJB-BULBTXNYSA-N |
| SMILES | CC12CCC(=O)C=C1CCC3C2(C(CC4(C3CCC4(C(=O)CO)O)C)O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |