For research use only. Not for therapeutic Use.
Flavanomarein（Cat No.:I044882）is a dihydrochalcone glycoside primarily isolated from Coreopsis tinctoria, a plant used in traditional medicine. Structurally, it consists of a flavonoid core with a glucose moiety, contributing to its solubility and biological activity. Flavanomarein exhibits notable antioxidant, anti-inflammatory, and antidiabetic effects. It has been shown to improve insulin sensitivity, reduce blood glucose levels, and protect against oxidative damage, making it a promising candidate for managing metabolic disorders. Its multifunctional pharmacological profile supports further research into its potential for functional foods and therapeutic applications in metabolic health.
| CAS Number | 577-38-8 |
| Synonyms | (2S)-2-(3,4-dihydroxyphenyl)-8-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C21H22O11 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-8-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O11/c22-7-15-16(26)18(28)19(29)21(32-15)31-13-4-2-9-11(24)6-14(30-20(9)17(13)27)8-1-3-10(23)12(25)5-8/h1-5,14-16,18-19,21-23,25-29H,6-7H2/t14-,15+,16+,18-,19+,21+/m0/s1 |
| InChIKey | DGGOLFCPSUVVHX-RTHJTPBESA-N |
| SMILES | C1[C@H](OC2=C(C1=O)C=CC(=C2O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C4=CC(=C(C=C4)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
