For research use only. Not for therapeutic Use.
FH1 (CAT: I000035 is a small molecule known for its ability to enhance the function and proliferation of cultured hepatocytes. It promotes the maintenance of hepatocyte-specific functions, such as albumin production, cytochrome P450 enzyme activity, and urea synthesis, which are critical for liver function. FH1 achieves this by modulating key signaling pathways that support cell survival and metabolic activity. This compound is widely used in liver disease research, drug metabolism studies, and the development of in vitro liver models for drug screening and toxicology testing, aiding in the advancement of regenerative medicine and hepatocyte-based therapies.
| CAS Number | 2719-05-3 |
| Synonyms | FH1;Methylenebis-4,4/’-acetanilide;NSC 12407 |
| Molecular Formula | C17H18N2O2 |
| Purity | ≥95% |
| Solubility | DMSO: ≥ 13 mg/mL |
| Storage | -20°C |
| IUPAC Name | N-[4-[(4-acetamidophenyl)methyl]phenyl]acetamide |
| InChI | InChI=1S/C17H18N2O2/c1-12(20)18-16-7-3-14(4-8-16)11-15-5-9-17(10-6-15)19-13(2)21/h3-10H,11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | OEXMNSOPAKOPEF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |