For research use only. Not for therapeutic Use.
FGFR2-IN-2（Cat No.:I044157）is a selective small-molecule inhibitor targeting fibroblast growth factor receptor 2 (FGFR2), a tyrosine kinase involved in cell proliferation, differentiation, and angiogenesis. Dysregulation or mutation of FGFR2 is implicated in various cancers, including cholangiocarcinoma, endometrial, and gastric cancers. FGFR2-IN-2 binds to the ATP-binding site of the kinase domain, blocking downstream signaling pathways such as MAPK and PI3K/AKT. It is used in preclinical cancer research to evaluate the therapeutic potential of FGFR2 blockade and to study resistance mechanisms. FGFR2-IN-2 supports development of targeted therapies in FGFR2-driven malignancies.
| CAS Number | 2677709-81-6 |
| Synonyms | 4-[3-(4-piperazin-1-ylphenyl)-1H-indazol-6-yl]phenol |
| Molecular Formula | C23H22N4O |
| Purity | ≥95% |
| IUPAC Name | 4-[3-(4-piperazin-1-ylphenyl)-1H-indazol-6-yl]phenol |
| InChI | InChI=1S/C23H22N4O/c28-20-8-3-16(4-9-20)18-5-10-21-22(15-18)25-26-23(21)17-1-6-19(7-2-17)27-13-11-24-12-14-27/h1-10,15,24,28H,11-14H2,(H,25,26) |
| InChIKey | OYKIIJTXTXJYKZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=NNC4=C3C=CC(=C4)C5=CC=C(C=C5)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
