For research use only. Not for therapeutic Use.
FGFR2-IN-1（Cat No.:I044158）is a potent and selective inhibitor of fibroblast growth factor receptor 2 (FGFR2), a receptor tyrosine kinase involved in cell growth, survival, and differentiation. Aberrant FGFR2 signaling—due to overexpression, mutations, or fusions—is associated with various cancers, including intrahepatic cholangiocarcinoma and gastric cancer. FGFR2-IN-1 blocks ATP binding to the kinase domain, suppressing downstream pathways such as MAPK and PI3K/AKT. It is widely used in cancer research to investigate FGFR2-driven oncogenesis, resistance mechanisms, and to evaluate targeted therapy strategies. FGFR2-IN-1 serves as a valuable tool for precision oncology studies.
| CAS Number | 2677709-76-9 |
| Synonyms | N-[6-(3-ethoxyphenyl)-1H-indazol-3-yl]benzamide |
| Molecular Formula | C22H19N3O2 |
| Purity | ≥95% |
| IUPAC Name | N-[6-(3-ethoxyphenyl)-1H-indazol-3-yl]benzamide |
| InChI | InChI=1S/C22H19N3O2/c1-2-27-18-10-6-9-16(13-18)17-11-12-19-20(14-17)24-25-21(19)23-22(26)15-7-4-3-5-8-15/h3-14H,2H2,1H3,(H2,23,24,25,26) |
| InChIKey | QKJLYUUEYRTLCL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=CC3=C(C=C2)C(=NN3)NC(=O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
