For research use only. Not for therapeutic Use.
Fervenulin(CAT: I016429) is a naturally occurring pyranonaphthoquinone antibiotic originally isolated from Streptomyces species. It exhibits notable antimicrobial and cytotoxic activities, making it an important reference compound in natural product chemistry and pharmacological research. Fervenulin functions by interfering with key cellular processes, including DNA and protein synthesis, contributing to its antibacterial and anticancer properties. Due to its redox-active quinone structure, it is also studied for its ability to generate reactive oxygen species (ROS), offering insights into oxidative stress mechanisms. Fervenulin is widely applied in microbiology, oncology, and natural product drug discovery as a tool for exploring novel therapeutic strategies.
| CAS Number | 483-57-8 |
| Synonyms | 6,8-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| Molecular Formula | C7H7N5O2 |
| Purity | ≥95% |
| IUPAC Name | 6,8-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChI | InChI=1S/C7H7N5O2/c1-11-5-4(8-3-9-10-5)6(13)12(2)7(11)14/h3H,1-2H3 |
| InChIKey | RRTKVYSLIGQWCO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N=CN=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
