For research use only. Not for therapeutic Use.
Ferrous Oxalate Dihydrate(CAT: L026856) is a high-purity iron (II) salt with two oxalate ligands and two water molecules of crystallization. This compound is widely utilized in chemical, pharmaceutical, and material science research as a precursor for iron-based materials, catalysts, and pigments. Its defined composition makes it ideal for controlled thermal decomposition, producing iron oxides used in magnetic and electronic applications. Additionally, Ferrous Oxalate Dihydrate plays a key role in redox chemistry, coordination studies, and as a reagent in analytical chemistry. With excellent stability and reliability, it serves as a versatile material for innovative scientific research and industrial applications.
| CAS Number | 6047-25-2 |
| Molecular Formula | C2H4FeO6 |
| Purity | ≥95% |
| IUPAC Name | iron(2+);oxalate;dihydrate |
| InChI | InChI=1S/C2H2O4.Fe.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+2;;/p-2 |
| InChIKey | NPLZZSLZTJVZSX-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)[O-])[O-].O.O.[Fe+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |