Ferrous carbonate(Cat No.:M015148), with the chemical formula FeCO₃, is a pale green mineral also known as siderite. It is used as a dietary iron supplement to treat iron deficiency anemia, providing a bioavailable form of iron that is essential for hemoglobin production and oxygen transport in the blood. Additionally, ferrous carbonate is employed in industrial applications, including water treatment and as a precursor in the synthesis of other iron compounds. Its utility in both healthcare and industry underscores its importance, though it must be handled carefully to prevent oxidation and maintain its efficacy.
Catalog Number | M015148 |
CAS Number | 563-71-3 |
Synonyms | FERROUS CARBONATE;FERROUS CARBONATE SACCHARATED;IRON (II) CARBONATE;IRON (II) CARBONATE, SACCHARATED;blaud’smass;Carbonicacid,iron(2+)salt(1:1);carbonicacid,iron(2++)salt(1:1);iron(2+)carbonate |
Molecular Formula | FeCO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | iron(2+);carbonate |
InChI | InChI=1S/CH2O3.Fe/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
InChIKey | RAQDACVRFCEPDA-UHFFFAOYSA-L |
SMILES | C(=O)([O-])[O-].[Fe+2] |