For research use only. Not for therapeutic Use.
Fenuron-d5 is a deuterated form of fenuron, a urea-based herbicide, where five hydrogen atoms are replaced with deuterium. This isotopically labeled compound is particularly valuable in environmental and agricultural research for studying the metabolic fate and degradation pathways of fenuron in soil and water systems. The incorporation of deuterium enhances the accuracy of analytical techniques such as mass spectrometry, allowing for precise tracking and quantification in various environmental matrices. Fenuron-d5 is essential for understanding the persistence, mobility, and ecological impact of fenuron, providing crucial insights for environmental safety assessments and regulatory compliance.
| CAS Number | 1219802-06-8 |
| Synonyms | Fenuron-d5 |
| Molecular Formula | C9H12N2O |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1,1-dimethyl-3-(2,3,4,5,6-pentadeuteriophenyl)urea |
| InChI | InChI=1S/C9H12N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,10,12)/i3D,4D,5D,6D,7D |
| InChIKey | XXOYNJXVWVNOOJ-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)N(C)C)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |