For research use only. Not for therapeutic Use.
Fenthoxon(CAT: R046843) is an organophosphate compound primarily used as a pesticide and insecticide. It functions by inhibiting acetylcholinesterase, an enzyme crucial for the breakdown of acetylcholine, a neurotransmitter. By disrupting the normal nerve signaling processes in pests, Fenthoxon causes paralysis and eventually death. Like other organophosphates, it is highly effective against a wide range of insects but can pose serious risks to humans, animals, and the environment due to its toxicity. Consequently, its usage is often regulated, and exposure to Fenthoxon requires proper safety measures to avoid potential health hazards, particularly in agricultural and industrial applications.
| CAS Number | 6552-12-1 |
| Synonyms | Phosphoric Acid Dimethyl 3-methyl-4-(methylthio)phenyl Ester; Phosphoric Acid Dimethyl 4-(Methylthio)-m-tolyl Ester; Bayoxon; Fenoxon; Fenthion Oxon; |
| Molecular Formula | C10H15O4PS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | dimethyl (3-methyl-4-methylsulfanylphenyl) phosphate |
| InChI | InChI=1S/C10H15O4PS/c1-8-7-9(5-6-10(8)16-4)14-15(11,12-2)13-3/h5-7H,1-4H3 |
| InChIKey | ZNRZGJAHNMGWQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OP(=O)(OC)OC)SC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |