For research use only. Not for therapeutic Use.
Febuxostat sec-butoxy acid（Cat No.:I014938）is a process-related impurity associated with the synthesis and stability evaluation of febuxostat, a xanthine oxidase inhibitor used in the treatment of gout and hyperuricemia. As a reference standard, it is critical for analytical method development, impurity profiling, and quality control to ensure drug safety and regulatory compliance. Researchers employ Febuxostat sec-butoxy acid to investigate febuxostat’s degradation pathways, assess metabolic intermediates, and support pharmaceutical development. Its defined structure and characterization make it a valuable tool in analytical, medicinal, and regulatory chemistry studies.
| CAS Number | 1335202-59-9 |
| Synonyms | 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| Molecular Formula | C16H16N2O3S |
| Purity | ≥95% |
| IUPAC Name | 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChI | InChI=1S/C16H16N2O3S/c1-4-9(2)21-13-6-5-11(7-12(13)8-17)15-18-10(3)14(22-15)16(19)20/h5-7,9H,4H2,1-3H3,(H,19,20) |
| InChIKey | HNNODDVYKUBOBQ-UHFFFAOYSA-N |
| SMILES | CCC(C)OC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
