For research use only. Not for therapeutic Use.
FBPase-IN-1（Cat No.:R051557）is a selective inhibitor of fructose-1,6-bisphosphatase (FBPase), an enzyme involved in gluconeogenesis, the process by which glucose is synthesized in the liver. By inhibiting FBPase, FBPase-IN-1 can reduce glucose production, making it a potential therapeutic agent for managing conditions like type 2 diabetes and metabolic disorders associated with elevated blood glucose levels. This compound is being studied for its ability to regulate glucose metabolism without causing significant hypoglycemia. Ongoing research is focused on evaluating its efficacy, safety, and potential as a treatment option for metabolic diseases.
| CAS Number | 20362-54-3 |
| Synonyms | 2-(1,3-thiazol-2-yldisulfanyl)-1,3-thiazole |
| Molecular Formula | C6H4N2S4 |
| Purity | ≥95% |
| IUPAC Name | 2-(1,3-thiazol-2-yldisulfanyl)-1,3-thiazole |
| InChI | InChI=1S/C6H4N2S4/c1-3-9-5(7-1)11-12-6-8-2-4-10-6/h1-4H |
| InChIKey | MZIWZDMEFARRSI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)SSC2=NC=CS2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
