For research use only. Not for therapeutic Use.
FBA-IN-1（Cat No.:I044070）is a potent inhibitor of fructose-1,6-bisphosphate aldolase (FBA), a key glycolytic enzyme that catalyzes the reversible cleavage of fructose-1,6-bisphosphate into glyceraldehyde-3-phosphate and dihydroxyacetone phosphate. By targeting FBA, FBA-IN-1 disrupts glycolytic flux, making it a valuable tool in studying metabolic regulation, cancer cell metabolism, and pathogen-specific aldolases in infectious diseases. Its selective inhibition allows researchers to explore FBA’s role in cellular energy balance and metabolic adaptation. FBA-IN-1 is instrumental in developing anti-cancer and anti-parasitic strategies targeting aberrant or parasite-specific glycolytic pathways.
| CAS Number | 2605897-57-0 |
| Synonyms | 2-(4-ethylphenyl)-1,2-benzoselenazol-3-one |
| Molecular Formula | C15H13NOSe |
| Purity | ≥95% |
| IUPAC Name | 2-(4-ethylphenyl)-1,2-benzoselenazol-3-one |
| InChI | InChI=1S/C15H13NOSe/c1-2-11-7-9-12(10-8-11)16-15(17)13-5-3-4-6-14(13)18-16/h3-10H,2H2,1H3 |
| InChIKey | MCSRHGLYNCIRNI-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3[Se]2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
