For research use only. Not for therapeutic Use.
FB49(CAT: I040281) is a highly selective inhibitor of Bcl-2-associated athanogene 3 (BAG3), exhibiting a KIof 45 μM. BAG3 is a co-chaperone protein involved in cell survival, stress response, and proteostasis regulation, particularly in cancer cells. FB49 inhibits tumor cell proliferation, notably in medulloblastoma HD-MB03 cells, where it induces G1 phase cell cycle arrest, apoptosis, and autophagy. Importantly, FB49 shows minimal toxicity toward human peripheral blood mononuclear cells (PBMCs), indicating selective action against malignant cells. It serves as a valuable chemical probe for studying BAG3-associated signaling pathways and for preclinical evaluation in cancer research.
| Synonyms | (5Z)-5-[(2,3-dihydroxyphenyl)methylidene]-3-(1-morpholin-4-yl-1-oxopropan-2-yl)-1,3-thiazolidine-2,4-dione |
| Molecular Formula | C17H18N2O6S |
| Purity | ≥95% |
| IUPAC Name | (5Z)-5-[(2,3-dihydroxyphenyl)methylidene]-3-(1-morpholin-4-yl-1-oxopropan-2-yl)-1,3-thiazolidine-2,4-dione |
| InChI | InChI=1S/C17H18N2O6S/c1-10(15(22)18-5-7-25-8-6-18)19-16(23)13(26-17(19)24)9-11-3-2-4-12(20)14(11)21/h2-4,9-10,20-21H,5-8H2,1H3/b13-9- |
| InChIKey | SKJITVGQMCOZBC-LCYFTJDESA-N |
| SMILES | CC(C(=O)N1CCOCC1)N2C(=O)C(=CC3=C(C(=CC=C3)O)O)SC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
