For research use only. Not for therapeutic Use.
FAUC 346（Cat No.:I044471）is a selective, non-peptidic antagonist of the oxytocin receptor (OXTR), a G protein-coupled receptor involved in social behavior, emotional regulation, uterine contraction, and lactation. By blocking oxytocin signaling, FAUC 346 is used to investigate the physiological and behavioral roles of the oxytocinergic system, particularly in neuropsychiatric conditions such as autism spectrum disorder, anxiety, and social dysfunction. Its non-peptidic structure provides enhanced metabolic stability and brain permeability compared to peptide-based antagonists. FAUC 346 is a valuable pharmacological tool for studying oxytocin receptor biology and developing CNS-targeted therapeutics.
| CAS Number | 474432-65-0 |
| Synonyms | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1-benzothiophene-2-carboxamide |
| Molecular Formula | C24H29N3O2S |
| Purity | ≥95% |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1-benzothiophene-2-carboxamide |
| InChI | InChI=1S/C24H29N3O2S/c1-29-21-10-4-3-9-20(21)27-16-14-26(15-17-27)13-7-6-12-25-24(28)23-18-19-8-2-5-11-22(19)30-23/h2-5,8-11,18H,6-7,12-17H2,1H3,(H,25,28) |
| InChIKey | KFMBPIZMZUDONQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCCNC(=O)C3=CC4=CC=CC=C4S3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
