Fast Blue Salt B(CAT: R071064) is a chemical compound commonly used as a dye in various applications, particularly in the field of histology and staining techniques. This dye belongs to the group of anionic dyes and is known for its affinity to specific biological structures. In histology, Fast Blue Salt B may be employed to stain tissues and cells, aiding in the visualization and differentiation of specific components or structures under a microscope.
Catalog Number | R071064 |
CAS Number | 20282-70-6 |
Synonyms | Azoic diazo 48 |
Molecular Formula | C14H12N4O2+2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-(4-diazonio-3-methoxyphenyl)-2-methoxybenzenediazonium |
InChI | InChI=1S/C14H12N4O2/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2/h3-8H,1-2H3/q+2 |
InChIKey | QMMMCTXNYMSXLI-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)[N+]#N)OC)[N+]#N |